Zu "656820-32-5" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Reversine
Artikelnummer: TGM-T1825-100mg
Description: Reversine, a small synthetic purine analogue (2, 6-disubstituted purine), is a potent inhibitior of Aurora A/B/C(IC50s=150-500 nM). Target: Aurora Kinase, Adenosine Receptor, Autophagy. Smiles: C1CCC(CC1)Nc1nc(Nc2ccc(cc2)N2CCOCC2)nc2[nH]cnc12. References: Chen S, et al. J Am Chem Soc. 2004, 126(2),...
| Anwendung: | Purine analog, differentiation reversing or inducing agent |
| CAS | 656820-32-5 |
| MW: | 393.49 D |
ab 33,00 €
Reversine
Artikelnummer: Cay10004412-1
Reversine is a 2,6-disubstituted purine derivative that was originally found to induce dedifferentiation of C2C12 culture myoblast cells into stem cell progenitors when used at a concentration of 5 µM for four days. Depending on cell type, reversine promotes either differentiation or dedifferentiation. For example,...
| Schlagworte: | N6-cyclohexyl-N2-[4-(4-morpholinyl)phenyl]-9H-purine-2,6-diamine |
| Anwendung: | Control of cell fate |
| CAS | 656820-32-5 |
| MW: | 393.5 D |
ab 49,00 €
Reversine
Artikelnummer: LKT-R1885.1
Purine analog, differentiation reversing or inducing agent.
| Anwendung: | Purine analog, differentiation reversing or inducing agent |
| CAS | 656820-32-5 |
| MW: | 393.5 D |
ab 142,00 €
