Zu "65678-07-1" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
AG-1024
Artikelnummer: Cay14833-1
The binding of insulin-like growth factor 1 (IGF-1) to the IGF-1 receptor (IGF-1R) initiates a cascade of reactions that promote cell growth and transformation by activating the PI3K/Akt signaling pathway, inhibiting apoptotic pathways, and mediating mitogenic actions. Overexpression of IGF-1R confers tumorigenic...
| Schlagworte: | AGS 200, Tyrphostin AG-1024, 2-[[3-bromo-5-(1,1-dimethylethyl)-4-hydroxyphenyl]methylene]-propanedinitrile |
| Anwendung: | IGF-1R inhibitor |
| CAS | 65678-07-1 |
| MW: | 305.2 D |
ab 76,00 €
AG-1024
Artikelnummer: LKT-A2400.1
Tyrphostin, IGF-1R inhibitor
| Schlagworte: | AG1024 (tyrphostin) |
| Anwendung: | Tyrphostin, IGF-1R inhibitor |
| CAS | 65678-07-1 |
| MW: | 305.17 D |
ab 96,00 €
AG1024
Artikelnummer: TGM-T2693-100mg
Description: AG1024 (Tyrphostin) suppresses IGF-1R autophosphorylation(IC50=7 µM), and is less potent for IR(IC50=57 µM). Target: IGF-1R, Apoptosis. Smiles: CC(C)(C)c1cc(C=C(C#N)C#N)cc(Br)c1O. References: Párrizas M, et al. Endocrinology. 1997 Apr,138(4):1427-33.
| Schlagworte: | Tyrphostin, AGS 200, Tyrphostin AG 1024 |
| CAS | 65678-07-1 |
| MW: | 305.17 D |
ab 33,00 €
