Zu "65162-13-2" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Methoxy-PMS
Artikelnummer: TGM-T4172-100mg
Description: Methoxy-PMS (1-Methoxyphenazine methosulfate) is stable electron-transport mediator between NAD(P)H and tetrazolium dyes, can induce active oxygen formation. Target: Reactive Oxygen Species. Smiles: COS([O-])(=O)=O.COc1cccc2[n+](C)c3ccccc3nc12. References: De Niz M et al. Tools for mass screening of...
| Schlagworte: | 1-Methoxyphenazine methosulfate, 1-Methoxy PMS |
| CAS | 65162-13-2 |
| MW: | 336.36 D |
ab 31,00 €
1-methoxy-5-Methylphenazinium (methyl sulfate)
Artikelnummer: Cay21258-25
1-methoxy-5-Methylphenazinium (methyl sulfate) is a photochemically stable mediator of electron transport between NADPH and various electron acceptors such as tetrazolium dyes. It can be used to visualize NAD-linked dehydrogenase activities.Formal Name: 1-methoxy-5-methyl-phenazinium, methyl sulfate. CAS Number:...
| Schlagworte: | 1-methoxy PMS, 1-Methoxyphenazine methosulfate, 1-methoxy-5-methyl-phenazinium, methyl sulfate |
| Anwendung: | Electron transport mediator |
| CAS | 65162-13-2 |
| MW: | 336.4 D |
ab 67,00 €
1-Methoxy-5-methylphenazinium Methyl Sulfate
Artikelnummer: LKT-M2077.100
Electron carrier used to study dehydrogenase electron transfer.
| Schlagworte: | 1-Methoxyphenazine methosulfate |
| Anwendung: | Electron carrier used to study dehydrogenase electron transfer |
| CAS | 65162-13-2 |
| MW: | 336.36 D |
ab 128,00 €
