Zu "64963-01-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
![[D-Ala2]leucine-enkephalin](https://www.biomol.com/media/image/4f/af/42/TGM-TP1367-2mg_200x200.png "[D-Ala2]leucine-enkephalin")
[D-Ala2]leucine-enkephalin
Artikelnummer: TGM-TP1367-100mg
Description: [D-Ala2]-Leucine enkephalin is a delta opioid agonist used to study the signaling pathway of delta opioid receptors. Target: Opioid Receptor. Smiles: CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(O)=O
| CAS | 64963-01-5 |
| MW: | 569.65 D |
ab 34,00 €
Pentapeptide-18
Artikelnummer: CSB-DT1722.1
Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...
| Schlagworte: | Tyr-D-Ala-Gly-Phe-Leu, YDAGFL |
| Anwendung: | Cosmetic peptide |
| CAS | 64963-01-5 |
| MW: | 569.658 D |
241,00 €
