Zu "64925-80-0" wurden 5 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Phomopsin A
Artikelnummer: Cay19448-1
Phomopsins are a family of mycotoxins produced by the fungus D. toxica, which predominantly infects lupines. Ingestion of lupines infected with D. toxica causes lupinosis, a degenerative disorder that can result in acute liver damage, brain damage, and death. Phomopsin A is a cyclic hexapeptide mycotoxin that binds...
| Schlagworte: | NSC 381839,... |
| Anwendung: | Microtubule growth inhibitor, beta-tubulin binding |
| CAS | 64925-80-0 |
| MW: | 789.2 D |
ab 504,00 €
Phomopsin A
Artikelnummer: P3970.1
Phomopsin A is an acidic 13-membered cyclic hexapeptide-like metabolite with three unusual amino acids linked in an "ansa" macrocycle with a three amino acid "tail", terminating in a dicarboxylic acid. Phomopsin A is a potent mycotoxin produced by the fungus Phomopsis leptostromiformis and is the causative agent of...
| CAS | 64925-80-0 |
| MW: | 789,2 D |
653,00 €
Phomopsin A
Artikelnummer: AG-CN2-0515-M001
Isolated from Phomopsis leptostromiformis. White solid. Soluble in DMSO (10mg/ml), ethanol, methanol (5mg/ml) or DMF. Macrocyclic heptapeptide mycotoxin. Potent anti-mitotic compound that can cause cell death. Microtubule assembly inhibitor. Binds selectively to dimeric tubulin, inhibiting the formation of the...
| Schlagworte: | PHO-A, NSC 381839 |
| Anwendung: | Mycotoxin, Microtubule assembly inhibitor |
| CAS | 64925-80-0 |
| MW: | 789.2 D |
440,00 €
Phomopsin A
Artikelnummer: LKT-P298576.1
| Schlagworte: | Phomopsin, AC1O5PXJ, PHO-A, NSC 381839, Phomopsin A |
| Anwendung: | Microtubule growth inhibitor, Beta-tubulin binding |
| CAS | 64925-80-0 |
| MW: | 789.24 D |
ab 703,00 €
Phomopsin A
Artikelnummer: TGM-T12448-100mg
Description: Phomopsin A, a cyclic hexapeptide mycotoxin, is isolated from the fungus Phomopsis leptostomiformis. Target: Others. Smiles: [H][C@]1(C=CCN1C(=O)[C@@]1([H])NC(=O)[C@@H](NC(=O)[C@@H](NC)[C@@H](O)c2cc(Cl)c(O)c(O[C@]1(C)CC)c2)C(C)=C)C(=O)N\C(=C(/C)CC)C(=O)N\C(=C\C(O)=O)C(O)=O. References: Hamel E, et al....
| Anwendung: | Microtubule growth inhibitor, beta-tubulin binding |
| CAS | 64925-80-0 |
| MW: | 789.23 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
