Zu "64657-18-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
1,9-dideoxy Forskolin
Artikelnummer: Cay11664-1
Forskolin (Cay-11018) is a naturally-occurring diterpene that activates adenylyl cyclase through its catalytic subunit and is commonly used to raise levels of cAMP in a wide variety of intact cells and tissue preparations. 1,9-dideoxy Forskolin is an analog of forskolin that interacts with, but does not activate,...
| Schlagworte: | (3R,4aS,5S,6S,6aS,10aS,10bR)-5-(acetyloxy)-3-ethenyldodecahydro-6-hydroxy-3,4a,7,7,10a-pentamethyl-1H-naphtho[2,1-b]pyran-... |
| Anwendung: | Adenylate cyclase binding |
| CAS | 64657-18-7 |
| MW: | 378.5 D |
ab 78,00 €
1,9-Dideoxyforskolin
Artikelnummer: TGM-T22467-5mg
Description: The compound is an inactive analog of forskolin(an adenylyl cyclase activator). Target: Others. Smiles: C[C@]12[C@@]([C@]3(C)[C@@]([C@H](O)[C@@H]1OC(C)=O)(C(C)(C)CCC3)[H])(C(=O)C[C@@](C=C)(C)O2)[H]
| Anwendung: | Adenylate cyclase binding |
| CAS | 64657-18-7 |
| MW: | 378.5 D |
ab 142,00 €
