Zu "64577-63-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Trifluoroacetyl tripeptide-2
Artikelnummer: TGM-T80948-50mg
Description: Trifluoroacetyl tripeptide-2, a bioactive peptide recognized for its anti-aging properties, is utilized as a cosmetic ingredient [1]. Smiles: [C@@H](CC1=CC=C(O)C=C1)(NC([C@@H](NC(C(F)(F)F)=O)[C@@H](C)C)=O)C(N[C@@H]([C@H](C)C)C(O)=O)=O
| CAS | 64577-63-5 |
| MW: | 475.46 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Tripeptide-2
Artikelnummer: CSB-DT1706.1
Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...
| Schlagworte: | TFA-Val-Try-Val, TFA-VYV |
| Anwendung: | Cosmetic peptide |
| CAS | 64577-63-5 |
| MW: | 475.5 D |
343,00 €
