Zu "64090-98-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
(S)-2-Amino-3-(pyridin-3-yl)propanoic acid
Artikelnummer: TGM-T64741-5mg
Description: (S)-2-Amino-3-(pyridin-3-yl)propanoic acid is a useful organic compound for research related to life sciences. The catalog number is T64741 and the CAS number is 64090-98-8. Smiles: N[C@@H](CC1=CC=CN=C1)C(O)=O
| CAS | 64090-98-8 |
| MW: | 166.18 D |
33,00 €
L-3-Pyridylalanine
Artikelnummer: CSB-DT3304.1
Amino acids are the basic units of proteins, which are linked by peptide bonds to form polypeptide chains that fold into proteins with specific functions. There are 20 common standard amino acids in nature, primarily distinguished by their side chains (R-groups). These differences give amino acids different...
| CAS | 64090-98-8 |
| MW: | 166.18 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
