Zu "63902-38-5" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Pinoresinol Diglucoside
Pinoresinol Diglucoside

Artikelnummer: Cay27708-10

Pinoresinol diglucoside is a lignan that has been found in E. ulmoides and has diverse biological activities. It inhibits peroxidation of a linoleic acid emulsion by 64.2% when used at a concentration of 20 µg/ml, scavenges hydrogen peroxide and 2,2-diphenyl-1-picrylhydrazyl (DPPH, Cay-14805), ABTS (Cay-27317), and...
Schlagworte: (+)-Pinoresinol di-O-beta-D-glucopyranoside,...
Anwendung: Bioactive lignan
CAS 63902-38-5
MW: 682.7 D
ab 102,00 €
Bewerten
Pinoresinol diglucoside
Pinoresinol diglucoside

Artikelnummer: TGM-T6S0535-100mg

Description: 1. Pinoresinol diglucoside (Pinoresinol Diglucopyranoside) is a putative alpha-glucosidase inhibiting compound. 2. Pinoresinol diglucoside is a important antihypertensive compound. Target: Glucosidase. Smiles: COc1cc(ccc1OC1OC(CO)C(O)C(O)C1O)C1OCC2C1COC2c1ccc(OC2OC(CO)C(O)C(O)C2O)c(OC)c1. References:...
Schlagworte: Pinoresinol Diglucopyranoside
CAS 63902-38-5
MW: 682.67 D
ab 43,00 €
Bewerten