Zu "6385-02-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Meclofenamate (sodium salt)
Artikelnummer: Cay70550-1
A time-dependent, non-specific COX inhibitor with IC50 values of 1.5 and 9.7 µM for human recombinant COX-1 and COX-2, respectively. Formulation: A crystalline solid. InChI: InChI=1S/C14H11Cl2NO2.Na/c1-8-6-7-10(15)13(12(8)16)17-11-5-3-2-4-9(11)14(18)19,/h2-7,17H,1H3,(H,18,19),/q,+1/p-1. InChIKey:...
| Schlagworte: | Meclofenamic Acid, 2-[(2,6-dichloro-3-methylphenyl)amino]-benzoic acid, monosodium salt |
| Anwendung: | Time-dependent, non-specific competitive COX inhibitor |
| CAS | 6385-02-0 |
| MW: | 318.1 D |
ab 83,00 €
Meclofenamic acid sodium
Artikelnummer: TGM-T0260-100mg
Description: Meclofenamic acid sodium (Movens), a non-steroidal anti-inflammatory agent, has properties of antipyretic and antigranulation activities. It also inhibits prostaglandin biosynthesis. Target: Gap Junction Protein, COX. Smiles: [NaH].Cc1ccc(Cl)c(Nc2ccccc2C(O)=O)c1Cl. References: Soriano-Hernández AD, et...
| Schlagworte: | Meclofenamate Sodium, Movens, Meclonax, Meclomen |
| CAS | 6385-02-0 |
| MW: | 318.14 D |
ab 32,00 €
