Zu "62666-20-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NEU
Progabide
Artikelnummer: Cay45568-10
Progabide is a GABA receptor agonist. It selectively binds to the GABAA and GABAB receptors in postmortem rat cortical membranes (IC50s = 35 and 100 µM, respectively) over alpha- and beta-adrenergic, dopamine, serotonin, histamine H1, and muscarinic receptors (IC50s = >100 µM) in radioligand binding assays....
| Schlagworte: | SL 76002, 4-[[(4-chlorophenyl)(5-fluoro-2-hydroxyphenyl)methylene]amino]-butanamide |
| Anwendung: | GABA receptor agonist |
| CAS | 62666-20-0 |
| MW: | 334.78 D |
ab 64,00 €
Progabide
Artikelnummer: TGM-T16581-100mg
Description: Progabide (SL 76002) is an agonist of the gamma-aminobutyric acid receptor. Target: GABA Receptor. Smiles: NC(=O)CCC\N=C(\c1ccc(Cl)cc1)c1cc(F)ccc1O. References: Manev H, et al. Progabide, a GABA mimetic drug, stimulates the secretion of plasma corticosterone in rats. Pharmacol Biochem Behav. 1987...
| Schlagworte: | SL 76002, Halogabide, Gabrene, Gabren |
| Anwendung: | Targets gamma-aminobutyric acid type B receptor (GABBR) |
| CAS | 62666-20-0 |
| MW: | 334.77 D |
ab 30,00 €
