Zu "62572-94-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
O-Desmethyl Metoprolol
Artikelnummer: Cay21787-5
O-Desmethyl metoprolol is a metabolite of the beta1-adrenergic receptor (beta1-AR) antagonist metoprolol (Cay-15429). It is formed from metoprolol by the cytochrome P450 (CYP) isoform CYP2D6.Formal Name: 4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]-benzeneethanol. CAS Number: 62572-94-5. Synonyms: O-DMM, SL...
| Schlagworte: | O-DMM, SL 80-0088, 4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]-benzeneethanol |
| Anwendung: | Metabolite |
| CAS | 62572-94-5 |
| MW: | 253.3 D |
ab 67,00 €
O-Desmethyl Metoprolol
Artikelnummer: TGM-T85293-10mg
Description: O-Desmethyl metoprolol, a metabolite of metoprolol, acts as a beta1-adrenergic receptor (beta1-AR) antagonist. This compound is produced through the metabolism of metoprolol by the cytochrome P450 (CYP) isoform CYP2D6. Target: Others. Smiles: CC(C)NCC(O)COc1ccc(CCO)cc1
| Schlagworte: | SL 80-0088, O-DMM |
| CAS | 62572-94-5 |
| MW: | 253.342 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
