Zu "62218-08-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
epsilon-Viniferin
Artikelnummer: TGM-T11218-100mg
Description: epsilon-Viniferin (epsilon-Viniferin) a dimer of resveratrol, shows the inhibitory effects of epsilon-viniferin on human CYP1A1, CYP1A2, CYP1B1, CYP2A6, CYP2B6, CYP2E1, CYP3A4 and CYP4A activities. Target: P450. Smiles: Oc1ccc(\C=C\c2cc(O)cc3O[C@H]([C@@H](c23)c2cc(O)cc(O)c2)c2ccc(O)cc2)cc1. References:...
| Schlagworte: | epsilon-Viniferin |
| CAS | 62218-08-0 |
| MW: | 454.47 D |
ab 311,00 €
trans-epsilon-Viniferin
Artikelnummer: Cay25737-1
trans-epsilon-Viniferin is a stilbene polyphenol and dimer of trans-resveratrol (Cay-70675) that has been found in various red wines and has diverse biological activities. It induces disaggregation of aggregated amyloid-beta (1-42) (Abeta42, Cay-20574) fibrils in a cell-free assay and decreases Abeta42- and...
| Schlagworte: | (-)-epsilon-Viniferin,... |
| Anwendung: | Bioactive polyphenol |
| CAS | 62218-08-0 |
| MW: | 454.5 D |
ab 85,00 €
