Zu "61413-54-5" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Rolipram
Artikelnummer: TGM-T6644-50mg
Description: Rolipram (SB 95952) is a phosphodiesterase 4 inhibitor with antidepressant properties. Target: HIV Protease, Antibacterial, PDE. Smiles: O(C1=C(OC)C=CC(=C1)C2CNC(=O)C2)C3CCCC3. References: MacKenzie SJ, et al. Action of rolipram on specific PDE4 cAMP phosphodiesterase isoforms and on the...
| Schlagworte: | (R,S)-Rolipram, ZK 62711, SB 95952 |
| Anwendung: | Targets cAMP-specific phosphodiesterase 4 [EC:3.1.4.53] (PDE4) |
| CAS | 61413-54-5 |
| MW: | 275.34 D |
ab 43,00 €
(±)-Rolipram
Artikelnummer: Cay10011132-5
Type 4 cyclic nucleotide phosphodiesterases (PDE4) isoforms selectively inactivate the second messenger cAMP by hydrolyzing the phosphodiester bond, producing AMP. (±)-Rolipram is a cell-permeable selective PDE4 inhibitor. Since PDE4 is abundant in leukocytes, (±)-rolipram inhibits inflammation by suppressing...
| Schlagworte: | SB 95952, ZK 62711, 4-[3-(cyclopentyloxy)-4-methoxyphenyl]-2-pyrrolidinone |
| Anwendung: | PDE4 inhibitor |
| CAS | 61413-54-5 |
| MW: | 275.3 D |
ab 40,00 €
Rolipram
Artikelnummer: LKT-R5745.10
Anxiolytic-like agent that stimulates angiogenesis.
| Schlagworte: | ZK62711 |
| Anwendung: | Phosphodiesterase (PDE) IV inhibitor |
| CAS | 61413-54-5 |
| MW: | 275.35 D |
ab 164,00 €
