Zu "603151-83-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NBI 35965 (mesylate)
Artikelnummer: Cay18524-1
Corticotropin-releasing hormone, also known as corticotropin-releasing factor (CRF) or corticoliberin, is a peptide hormone and neurotransmitter involved in the stress response. It is secreted from the hypothalamus and is the major regulator of pituitary corticotropin-release and consequent glucocorticoid secretion....
| Schlagworte: | (7S)-6-(cyclopropylmethyl)-2-(2,4-dichlorophenyl)-7-ethyl-7,8-dihydro-4-methyl-6H-1,3,6,8a-tetraazaacenaphthylene,... |
| Anwendung: | CRF1 antagonist |
| CAS | 603151-83-3 |
| MW: | 497.4 D |
ab 47,00 €
NBI 35965 methanesulfonate
Artikelnummer: TGM-T23058-10mg
Description: NBI 35965 methanesulfonate is a CRF1 antagonist. Target: Others. Smiles: CS(O)(=O)=O.CC[C@H]1Cn2nc(-c3ccc(Cl)cc3Cl)c3nc(C)cc(N1CC1CC1)c23
| CAS | 603151-83-3 |
| MW: | 497.44 D |
ab 102,00 €
