Zu "5988-19-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
L-Dihydroorotic Acid
Artikelnummer: Cay45688-1
L-Dihydroorotic acid is an intermediate in the de novo pyrimidine biosynthesis pathway. It is formed from carbamoyl phosphate by dihydroorotase and converted into orotic acid by dihydroorotate dehydrogenase (DHODH).. SMILES: OC([C@@H]1CC(NC(N1)=O)=O)=O. InChi Code:...
| Schlagworte: | L-Dihydroorotate, hexahydro-2,6-dioxo-4S-pyrimidinecarboxylic acid |
| Anwendung: | Pyrimidine biosynthesis intermediate |
| CAS | 5988-19-2 |
| MW: | 158.11 D |
ab 244,00 €
L-Dihydroorotic acid
Artikelnummer: TGM-T4880-100mg
Description: L-Dihydroorotic acid, also known as (S)-4,5-dihydroorotate or dihydro-L-orotate, belongs to the class of organic compounds known as alpha amino acids and derivatives. Within the cell, L-dihydroorotic acid is primarily located in the cytoplasm and mitochondria. L-Dihydroorotic acid exists in all...
| Schlagworte: | L-Hydroorotic acid |
| CAS | 5988-19-2 |
| MW: | 158.11 D |
ab 30,00 €
