Zu "5980-33-6" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Cantabiline sodium
Cantabiline sodium

Artikelnummer: TGM-T30703-25mg

Description: Cantabiline sodium is a coumarin derivative possessing properties as a spasmolytic, choleretic and light-protective agent. It is also used in analytical chemistry for the determination of NITRIC ACID. Target: Others. Smiles: [Na].Cc1cc(=O)oc2cc(O)ccc12. References: Chevrel B. [Action of cantabiline on...
Schlagworte: LM 94 sodium, Hymecromone sodium
CAS 5980-33-6
MW: 199.161 D
1.440,00 €
Bewerten
4-Methylumbelliferone sodium salt
4-Methylumbelliferone sodium salt

Artikelnummer: CDX-M0577-G010

CAS 5980-33-6
ab 131,00 €
Bewerten