Zu "587871-26-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ku-55933
Artikelnummer: Cay16336-1
Ku-55933 is a potent ATP-competitive inhibitor of the ataxia-telangiectasia mutated (ATM) kinase (IC50 = 13 nM, Ki = 2.2 nM). Inhibition of ATM by Ku-55933 blocks radiation-induced phosphorylation of downstream cellular targets and sensitizes cells to the cytotoxic effects of both ionizing radiation and...
| Schlagworte: | ATM Kinase Inhibitor, 2-(4-morpholinyl)-6-(1-thianthrenyl)-4H-pyran-4-one |
| Anwendung: | Potent ATP-competitive ATM kinase inhibitor |
| CAS | 587871-26-9 |
| MW: | 395.5 D |
ab 42,00 €
KU-55933
Artikelnummer: TGM-T2685-100mg
Description: KU-55933 (ATM Kinase Inhibitor) is a potent and specific ATM inhibitor. Target: DNA-PK, PI3K, mTOR, ATM/ATR, Autophagy. Smiles: O=c1cc(oc(c1)-c1cccc2Sc3ccccc3Sc12)N1CCOCC1. References: Hickson I, et al. Cancer Res. 2004, 64(24), 9152-9159.
| Schlagworte: | ATM Kinase Inhibitor |
| CAS | 587871-26-9 |
| MW: | 395.49 D |
ab 41,00 €
