Zu "58-32-2" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Dipyridamole
Artikelnummer: TGM-T1618-100mg
Description: Dipyridamole (Persantin) is a Platelet Aggregation Inhibitor. The physiologic effect of dipyridamole is by means of Decreased Platelet Aggregation. Target: PDE. Smiles: N(CCO)(CCO)C1=NC2=C(C(=N1)N3CCCCC3)N=C(N(CCO)CCO)N=C2N4CCCCC4. References: Fujishige K, et al. J Biol Chem. 1999 Jun 25,274(26):18438-45.
| Schlagworte: | Dypyridamole, Dipyridamol, Persantin, NSC-515776, Dipyudamine |
| Anwendung: | Targets cGMP-specific 3',5'-cyclic phosphodiesterase [EC:3.1.4.35] (PDE5) |
| CAS | 58-32-2 |
| MW: | 504.63 D |
ab 31,00 €
Dipyridamole
Artikelnummer: Cay18189-5
Dipyridamole is a phosphodiesterase 5A (PDE5A) inhibitor (IC50 = 574 nM) that prevents platelet aggregation by increasing cGMP levels and blocking the reuptake of adenosine via red blood cells. It also scavenges the free radicals that inactivate cyclooxygenase, leading to the inhibition of platelet activation and...
| Schlagworte: | NSC 515776, NSC 619103, 2,2',2",2"'-[(4,8-di-1-piperidinylpyrimido[5,4-d]pyrimidine-2,6-diyl)dinitrilo]tetrakis-ethanol |
| Anwendung: | PDE5A inhibitor |
| CAS | 58-32-2 |
| MW: | 504.6 D |
ab 52,00 €
Dipyridamole
Artikelnummer: LKT-D3362.1
PDE and adenosine deaminase inhibitor.
| Schlagworte: | Anginal, Cardoxin, Coridil, Dipyridan, Gulliostin, Natyl, Persantine, Piroan, Protangix,... |
| Anwendung: | Phosphodiesterase (PDE) V inhibitor, equilibrative nucleoside transporter 1 (ENT1) inhibitor |
| CAS | 58-32-2 |
| MW: | 504.63 D |
ab 61,00 €
