Zu "57672-79-4" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Baccatin VI
Artikelnummer: LKT-T1024.1
| Schlagworte: | (2aR,4S,4aS,5R,6R,9S,11S,12S,12aR,12bS)-2a,3,4,4a,5,6,9,10,12,12a-Decahydro... |
| Anwendung: | Impurity |
| CAS | 57672-79-4 |
| MW: | 714.75 D |
ab 922,00 €
Baccatin VI
Artikelnummer: Cay39287-1
Baccatin VI is a taxane that has been found in T. baccata and has microtubule-stabilizing and antinociceptive activities. It inhibits cold-induced microtubule depolymerization with half-maximal inhibitory dose (ID50) values of 70 and 100 µM for isolated porcine brain and P. polycephalum microtubules, respectively....
| Schlagworte: | (2aR,4S,4aS,5R,6R,9S,11S,12S,12aR,12bS)-2a,3,4,4a,5,6,9,10,12,12a-decahydro-4a,8,13,13-tetramethyl-4,5,6,9,12b-pentaacetat... |
| Anwendung: | Taxane, microtubule-stabilizing / antinociceptive agent |
| CAS | 57672-79-4 |
| MW: | 714.8 D |
153,00 €
Baccatin VI
Artikelnummer: TGM-TN3476-1mg
Description: Baccatin VI possesses significant antinociceptive activity against p-benzoquinone-induced abdominal contractions. Target: Others. Smiles: O(C(C)=O)[C@]12[C@@]3([C@](C)([C@@H](OC(C)=O)[C@H](OC(C)=O)C=4C(C)(C)[C@](O)([C@H]3OC(=O)C5=CC=CC=C5)C[C@H](OC(C)=O)C4C)[C@@H](OC(C)=O)C[C@]1(OC2)[H])[H]. References:...
| CAS | 57672-79-4 |
| MW: | 714.75 D |
373,00 €
