Zu "57460-41-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
(±)-Talinolol
Artikelnummer: Cay16116-5
(±)-Talinolol is a beta1-selective adrenoceptor antagonist well known for its cardioprotective and antihypertensive activity. By blocking beta1-adrenergic receptors, talinolol delays the conduction of stimuli in the AV node, reduces the sino-atrial conduction time, and impedes the sinus node automaticity. Because...
| Schlagworte: | N-cyclohexyl-N'-[4-[3-[(1,1-dimethylethyl)amino]-2-hydroxypropoxy]phenyl]-urea |
| Anwendung: | beta1-adrenergic receptor antagonist |
| CAS | 57460-41-0 |
| MW: | 363.5 D |
ab 69,00 €
Talinolol
Artikelnummer: TGM-T21640-100mg
Description: (±)-Talinolol is a selective beta1 adrenoceptor antagonist well known for its cardioprotective and antihypertensive activity. Target: Adrenergic Receptor. Smiles: CC(C)(C)NCC(O)COC1=CC=C(NC(=O)NC2CCCCC2)C=C1
| Anwendung: | Antiarrhythmic, beta-Adrenergic receptor antagonist |
| CAS | 57460-41-0 |
| MW: | 363.49 D |
ab 30,00 €
