Zu "574013-66-4" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Fexaramine
Artikelnummer: TGM-T2015-100mg
Description: Fexaramine is a small molecule farnesoid X receptor (FXR) agonist with 100-fold increased affinity compared to natural compounds. Target: FXR, Autophagy. Smiles: COC(=O)\C=C\c1cccc(c1)N(Cc1ccc(cc1)-c1ccc(cc1)N(C)C)C(=O)C1CCCCC1. References: Lam IP, et al. Am J Physiol Gastrointest Liver Physiol. 2009...
| CAS | 574013-66-4 |
| MW: | 496.64 D |
ab 42,00 €
Fexaramine
Artikelnummer: Cay17369-10
The farnesoid X receptor (FXR) is a nuclear receptor that acts as a bile acid sensor, protecting cells and organs against bile acid toxicity and coordinating cholesterol metabolism, lipid homeostasis, and absorption of dietary fats and vitamins. Fexaramine is an FXR agonist (EC50 = 25 nM) that demonstrates 100-fold...
| Schlagworte: | 3-[3-[(cyclohexylcarbonyl)[[4'-(dimethylamino)[1,1'-biphenyl]-4-yl]methyl]amino]phenyl]-2-propenoic acid, methyl ester |
| Anwendung: | FXR agonist |
| CAS | 574013-66-4 |
| MW: | 496.6 D |
ab 44,00 €
Fexaramine
Artikelnummer: LKT-F1992.5
FXR agonist.
| Anwendung: | FXR agonist |
| CAS | 574013-66-4 |
| MW: | 496.65 D |
ab 257,00 €
