Zu "56786-63-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
5-alpha-Hydroxy-Laxogenin
Artikelnummer: TGM-T21253-100mg
Description: 5-alpha-Hydroxy-Laxogenin is an stress hormone cortisol inhibitor. Target: Others. Smiles: [H][C@]12C[C@@]3([H])[C@]4([H])CC(=O)[C@@]5(O)C[C@@H](O)CC[C@]5(C)[C@@]4([H])CC[C@]3(C)[C@@]1([H])[C@H](C)[C@@]1(CC[C@@H](C)CO1)O2
| CAS | 56786-63-1 |
| MW: | 446.62 D |
ab 31,00 €
5alpha-hydroxy Laxogenin
Artikelnummer: Cay27665-100
5alpha-hydroxy Laxogenin is a brassinosteroid analog and a derivative of diosgenin (Cay-19847). Topical administration of 5alpha-hydroxy laxogenin (4, 8, and 12 ppm), in combination with a commercial fertilizer, increases the yield and fresh weight of endives (C. endivia). It also inhibits sodium chloride-induced...
| Schlagworte: | Biobras-16, Brassinosteroid BB-16, Brassinosteroid DI-31, (3beta,5alpha,25R)-3,5-dihydroxyspirostan-6-one |
| Anwendung: | Brassinosteroid analog |
| CAS | 56786-63-1 |
| MW: | 446.6 D |
ab 259,00 €
