Zu "565-20-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
N-acetyl Dapsone
Artikelnummer: Cay17274-1
N-acetyl Dapsone is a metabolite of dapsone, an anti-inflammatory and antibacterial compound that is widely used in the treatment of leprosy, malaria, acne, and various immune disorders. Dapsone is acetylated in the liver to monoacetyldapsone, the major metabolite, and other mono and diacetyl derivatives, and...
| Schlagworte: | NSC 27184, N-[4-[(4-aminophenyl)sulfonyl]phenyl]-acetamide |
| Anwendung: | Dapsone metabolite |
| CAS | 565-20-8 |
| MW: | 290.3 D |
ab 58,00 €
N-acetyl Dapsone
Artikelnummer: TGM-T35903-100mg
Description: N-acetyl Dapsone is an anti-inflammatory and antimicrobial compound widely used in the treatment of leprosy, malaria, acne and various immune disorders. Target: Antibacterial, Parasite, Drug Metabolite. Smiles: S(=O)(=O)(C1=CC=C(NC(C)=O)C=C1)C2=CC=C(N)C=C2
| CAS | 565-20-8 |
| MW: | 290.34 D |
ab 120,00 €
