Zu "56353-15-2" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
N-Acetylcarnosine
Artikelnummer: TGM-TP1088-500mg
Description: N-Acetylcarnosine (N-Acetyl-L-carnosine) is thought to be able to combat some of the effects of oxidative stress as it has anti-oxidant properties. Target: Others. Smiles: CC(=O)NCCC(=O)N[C@@H](Cc1cnc[nH]1)C(O)=O. References: Babizhayev MA, et al. N-Acetylcarnosine, a natural histidine-containing...
| Schlagworte: | N-Acetyl-L-carnosine |
| CAS | 56353-15-2 |
| MW: | 268.27 D |
37,00 €
N-acetyl-L-Carnosine
Artikelnummer: Cay18817-1
N-acetyl-L-Carnosine is a dipeptide and acetylated form of L-carnosine (Cay-29825) that has been found in heart and skeletal muscle and has antioxidant and anticataract activities. It reduces iron- and ascorbate-induced malondialdehyde (MDA) accumulation in liposomes when used at concentrations of 10 and 20 mM....
| Schlagworte: | NAC, N-acetyl-beta-alanyl-L-histidine |
| Anwendung: | Antioxidant |
| CAS | 56353-15-2 |
| MW: | 268.3 D |
ab 44,00 €
N-acetyl-L-carnosine
Artikelnummer: CSB-DT1737.1
Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...
| Schlagworte: | Ac-beta-Ala-His, Ac-beta-AH |
| Anwendung: | Cosmetic peptide |
| CAS | 56353-15-2 |
| MW: | 268.272 D |
210,00 €
