Zu "56-88-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
L-(+)-Cystathionine
Artikelnummer: Cay16061-50
L-(+)-Cystathionine is a dipeptide formed by serine and homocysteine. Transsulfuration of methionine yields homocysteine, which combines with serine to form this precursor of cysteine. L-(+)-Cystathionine is largely expressed in the mammalian brain and deficiency can indicate the presence of metabolic disorders such...
| Schlagworte: | S-[(2R)-2-amino-2-carboxyethyl]-L-homocysteine |
| Anwendung: | Cysteine precursor |
| CAS | 56-88-2 |
| MW: | 222.3 D |
ab 73,00 €
L-Cystathionine
Artikelnummer: TGM-T10939L-1mg
Description: L-Cystathionine (Cystathionine, L-) is a key nonprotein amino acid related to metabolic conditions of sulfur-containing amino acids. L-Cystathionine can be used in studies about cardiovascular protection. Target: Endogenous Metabolite, Apoptosis. Smiles: N[C@@H](CCSC[C@H](N)C(O)=O)C(O)=O. References:...
| Schlagworte: | Cystathionine, Cystathionine, L-, ZINC1532680, L-(+)-Cystathionine |
| CAS | 56-88-2 |
| MW: | 222.26 D |
ab 38,00 €
