Zu "554-92-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Trimethobenzamide hydrochloride
Artikelnummer: TGM-T5009-100mg
Description: Trimethobenzamide hydrochloride (Ro 2-9578) is a blocker of the D2 receptor. Trimethobenzamide is an antiemetic used to prevent nausea and vomiting. Target: Dopamine Receptor, Influenza Virus. Smiles: Cl.COc1cc(cc(OC)c1OC)C(=O)NCc1ccc(OCCN(C)C)cc1. References: Smith HS, et al. Dopamine receptor...
| Schlagworte: | Tribenzagan Hydrochloride, Ro 2-9578 |
| Anwendung: | Antiemetic |
| CAS | 554-92-7 |
| MW: | 424.92 D |
ab 55,00 €
Trimethobenzamide (hydrochloride)
Artikelnummer: Cay24145-100
Trimethobenzamide is a dopamine D2 receptor antagonist and antiemetic. It prevents emesis induced by the dopamine agonist apomorphine (Cay-16094) in dogs when used at a dose of 20 mg/kg and stimulates contraction of isolated guinea pig ileum (ED50 = 8.7 µg/mL). Trimethobenzamide (20 mg/kg) decreases...
| Schlagworte: | Ro 2-9578, N-[[4-[2-(dimethylamino)ethoxy]phenyl]methyl]-3,4,5-trimethoxy-benzamide, monohydrochloride |
| Anwendung: | Dopamine D2 receptor antagonist, antiemetic |
| CAS | 554-92-7 |
| MW: | 424.9 D |
ab 87,00 €
