Zu "553-26-4" wurden 1 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
4,4'-Bipyridyl
Artikelnummer: Cay45661-10
4,4'-Bipyridyl is a building block that has been used as a ligand in coordination polymer chemistry and the synthesis of metal-organic frameworks (MOFs). It is also a synthetic intermediate that has been used in the synthesis of the herbicide paraquat (Cay38521).. SMILES: C1(C2=CC=NC=C2)=CC=NC=C1. InChi Code:...
| Schlagworte: | 4,4'B, 4,4'-Dipyridyl, BPY, NSC 404423 |
| Anwendung: | Building block, synthetic intermediate |
| CAS | 553-26-4 |
| MW: | 156.19 D |
ab 35,00 €
