Zu "549-06-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Stictic Acid
Artikelnummer: Cay25017-2.5
Stictic acid is a depsidone found in lichen. It preferentially inhibits growth of HT-29 human colon adenocarcinoma cells over non-malignant cells (IC50s = 29.29 and 2,478.4 µg/ml, respectively).Formal Name:...
| Schlagworte: | NSC 87511,... |
| Anwendung: | Bioactive depsidone |
| CAS | 549-06-4 |
| MW: | 386.3 D |
ab 235,00 €
Stictic Acid
Artikelnummer: TGM-T35673-10mg
Description: Stictic Acid (Scopularic acid) is isolated from a Sumatran lichen Stereocaulon montagneanum and inhibits the growth of HT-29 human colon adenocarcinoma cells with an IC50 of 29.29 µg/ml. Target: Others. Smiles: OC1C=2C3=C(C(C)=C(O)C2C(=O)O1)OC(=O)C=4C(O3)=C(C=O)C(OC)=CC4C. References: Ismed F, et al....
| Schlagworte: | Scopularic acid |
| CAS | 549-06-4 |
| MW: | 386.31 D |
ab 300,00 €
