Zu "548470-11-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ISRIB
Artikelnummer: TGM-T2027-5mg
Description: ISRIB is a potent and selective PERK inhibitor. Target: PERK. Smiles: Clc1ccc(OCC(=O)NC2CCC(CC2)NC(=O)COc2ccc(Cl)cc2)cc1. References: Sidrauski C, et al. Elife. 2013, 2, e00498.
| CAS | 548470-11-7 |
| MW: | 451.34 D |
ab 46,00 €
ISRIB
Artikelnummer: Cay41879-10
A mixture of cis-IRIB and trans-ISRIB, trans-ISRIB decreases ATF4-induced increases in gene transcription more effectively than cis-ISRIB in a reporter assay using HEK293T cells (IC50s = 5 and 600 nM, respectively), trans-ISRIB decreases the latency to escape in the Morris water maze and increases the length of...
| Schlagworte: | N,N'-1,4-cyclohexanediylbis[2-(4-chlorophenoxy)-acetamide |
| Anwendung: | Cis-IRIB / trans-ISRIB mixture |
| CAS | 548470-11-7 |
| MW: | 451.3 D |
ab 73,00 €
