Zu "54-21-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Sodium salicylate
Artikelnummer: CDX-S0145-G025
Sodium salicylate is a metabolite of aspirin. It is a cell-permeable, non-steroidal anti-inflammatory agent (NSAID) that interferes with TNF-induced NF-kappaB activation by inhibiting phosphorylation and subsequent degradation of the IkappaB-alpha protein. It selectively inhibits TNF-induced activation of p42 (ERK2)...
| Schlagworte: | 2-Hydroxybenzoic acid sodium salt |
| Anwendung: | Cell-permeable, non-steroidal anti-inflammatory agent (NSAID) |
| CAS | 54-21-7 |
| MW: | 160,1 D |
ab 44,00 €
Sodium salicylate
Artikelnummer: TGM-T0335-500mg
Description: Sodium salicylate (2-Hydroxybenzoic acid sodium salt), a metabolite of acetylsalicylic acid, can inhibit NF-kB and reduce oxidative stress. Target: NF-kappaB, S6 Kinase, COX, Apoptosis, Autophagy. Smiles: [Na+].Oc1ccccc1C(=O)[O-]. References: Kopp E, et al. Science, 1994, 265(5174), 956-959.
| Schlagworte: | 2-Hydroxybenzoic acid sodium salt, Salicylic acid sodium salt |
| CAS | 54-21-7 |
| MW: | 160.11 D |
43,00 €
