Zu "53671-71-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ICI 89406
Artikelnummer: Cay42370-10
A ß1-adrenergic receptor antagonist (IC50 = 4.2 nM), selective for ß1-adrenergic receptors over ß2-adrenergic receptors (IC50 = 678 nM), acts as a partial agonist at ß1- and ß2-adrenergic receptors, inducing cAMP accumulation in CHO-K1 cells expressing the human receptors (EC50s = 0.81 and 60.26 nM, respectively)....
| Schlagworte: | N-[2-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]-N'-phenyl-urea |
| Anwendung: | SS1-adrenergic receptor antagonist |
| CAS | 53671-71-9 |
| MW: | 354.4 D |
ab 73,00 €
ICI 89406
Artikelnummer: TGM-T22852-10mg
Description: ICI 89406 (1-[2-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]-3-phenylurea) is a beta-adrenergic antagonist. Target: Adrenergic Receptor. Smiles: OC(CNCCNC(=O)Nc1ccccc1)COc1ccccc1C#N. References: Marilyn P Law, et al. Are [O-methyl-11C]derivatives of ICI 89,406 beta1-adrenoceptor selective...
| Schlagworte: | 1-[2-[[3-(2-cyanophenoxy)-2-hydroxypropyl]amino]ethyl]-3-phenylurea |
| CAS | 53671-71-9 |
| MW: | 354.4 D |
ab 62,00 €
