Zu "5328-37-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
L-(+)-Arabinose
Artikelnummer: TGM-T13752-1g
Description: L-(+)-Arabinose selectively inhibits intestinal sucrase in a non-competitive manner, thereby preventing glucose elevation induced by sucrose intake. Target: Endogenous Metabolite. Smiles: [C@H]([C@H](CO)O)([C@H](C=O)O)O. References: Osaki S, et al. L-arabinose feeding prevents increases due to dietary...
| CAS | 5328-37-0 |
| MW: | 150.13 D |
ab 31,00 €
L-(+)-Arabinose
Artikelnummer: CDX-A0410-G025
L-Arabinose is the naturally occurring isomer and is a constituent of plant polysaccharides. It is more common than D-arabinose in nature as a component of biopolymers such as hemicellulose and pectin. Most bacteria contain an inducible arabinose operon that codes for a series of enzymes and transporters that allows...
| Schlagworte: | NSC 1941 |
| Anwendung: | Naturally occurring isomer, Plant polysaccharide constituent |
| CAS | 5328-37-0 |
| MW: | 150.13 D |
ab 68,00 €
