Zu "53-41-8" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Androsterone
Artikelnummer: TGM-T5264-10mg
Description: Androsterone, a metabolic product of testosterone, can activate Farnesoid X Receptor (FXR). Target: FXR, Autophagy, Endogenous Metabolite. Smiles: C[C@]12CC[C@H]3[C@@H](CC[C@H]4C[C@H](O)CC[C@]34C)[C@@H]1CCC2=O. References: Wang S, et al. The nuclear hormone receptor farnesoid X receptor (FXR) is...
| Schlagworte: | ??, 5alpha-Androsterone, 5alpha-Androstan-3alpha-ol-17-one, Androkinin |
| Anwendung: | Androgenic activity reference standard |
| CAS | 53-41-8 |
| MW: | 290.44 D |
ab 42,00 €
Androsterone
Artikelnummer: Cay15872-100
Androsterone is a steroid hormone produced in the body from 5alpha-reduced metabolites of dehydroepiandrosterone and possesses 7-fold weaker androgen potency compared to that of testosterone (Cay-15645). It is the major androgen excreted in urine as a metabolite of testosterone and is used as the international...
| Schlagworte: | Androkinin, NSC 9898, (5alpha)-3alpha-hydroxy-androstan-17-one |
| Anwendung: | Androgenic activity reference standard |
| CAS | 53-41-8 |
| MW: | 290.4 D |
ab 74,00 €
Androsterone
Artikelnummer: ISO-13413.1
Unlabeled
| Schlagworte: | unlabelled |
| Anwendung: | Steroid |
| CAS | 53-41-8 |
| MW: | 290 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Androsterone
Artikelnummer: ISO-S13413.100
| Schlagworte: | unlabelled |
| CAS | 53-41-8 |
| MW: | 290 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
