Zu "52549-17-4" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Pranoprofen
Artikelnummer: Cay17875-1
Pranoprofen is a non-steroidal anti-inflammatory drug (NSAID) and COX-1 inhibitor (IC50 = 3.1 µM). It decreases B. pertussis-induced production of prostaglandin E2 (PGE2, Cay-14010) in isolated rat peritoneal leukocytes (IC50 = 0.39 µM). Ocular application of pranoprofen reduces corneal epithelial damage in a mouse...
| Schlagworte: | Pyranoprofen, Y 8004, alpha-methyl-5H-[1]benzopyrano[2,3-b]pyridine-7-acetic acid |
| Anwendung: | COX-1 inhibitor |
| CAS | 52549-17-4 |
| MW: | 255.3 D |
ab 51,00 €
Pranoprofen
Artikelnummer: LKT-P6802.1
A non-steroidal antiinflammatory drug inhibits platelet aggregation.
| Anwendung: | COX-1/2 inhibitor |
| CAS | 52549-17-4 |
| MW: | 255,27 D |
ab 141,00 €
NEU
Pranoprofen
Artikelnummer: TGM-T0159-100mg
Description: Pranoprofen (Pyranoprofen) (INN) is a non-steroidal anti-inflammatory drug used in ophthalmology. Target: PGE Synthase, Prostaglandin Receptor, COX, Apoptosis. Smiles: CC(C(O)=O)c1ccc2Oc3ncccc3Cc2c1. References: Hosoi T, et al. Neurochem Int,2009, 54(1), 1-6.
| Schlagworte: | Pyranoprofen |
| CAS | 52549-17-4 |
| MW: | 255.27 D |
ab 30,00 €
