Zu "52497-36-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Dihydrokainic acid
Artikelnummer: LKT-D3328.10
The saturated analog of kainic acid. Reduction of the isopropylene side-chain destroys the affinity to binding sites. It enhances the antitumor activity of doxorubicin presumably acting as a glutamate transporter inhibitor.
| Anwendung: | Cancer studies |
| CAS | 52497-36-6 |
| MW: | 215,25 D |
ab 582,00 €
Dihydrokainic Acid
Artikelnummer: Cay28478-1
Dihydrokainic acid (DHK) is an inhibitor of excitatory amino acid transporter 2 (EAAT2, Ki = 23 µM for glutamate uptake by COS cells expressing EAAT2). It is selective for EAAT2 over EAAT1 and EAAT3 (Ki = >3 mM for both). DHK microinfusion (5 nmol) into the rat infralimbic cortex reduces the time spent immobile in...
| Schlagworte: | DHK, (2S,3S,4R)-2-carboxy-4-(1-methylethyl)-3-pyrrolidineacetic acid |
| Anwendung: | EAAT2 inhibitor |
| CAS | 52497-36-6 |
| MW: | 215.2 D |
ab 56,00 €
Dihydrokainic acid
Artikelnummer: TGM-T22722-10mg
Description: EAAT2(GLT1)-selective non-transportable inhibitor of L-glutamate and L-aspartate uptake. Target: Others. Smiles: CC(C)[C@H]1CN[C@@H]([C@H]1CC(O)=O)C(O)=O
| Anwendung: | EAAT2 inhibitor |
| CAS | 52497-36-6 |
| MW: | 215.25 D |
ab 174,00 €
