Zu "522649-59-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Malic Enzyme Inhibitor ME1
Artikelnummer: Cay44383-1
Malic enzyme inhibitor ME1 is an inhibitor of malic enzyme (ME, IC50s = 0.22, 0.2, and 0.15 µM for ME1, ME2, and ME3, respectively). InChI: InChI=1S/C20H21N3O3/c24-17-8-6-15(7-9-17)21-10-12-22(13-11-21)18-14-19(25)23(20(18)26)16-4-2-1-3-5-16/h1-9,18,24H,10-14H2 InChIKey: JJFJQFJFFVLMCX-UHFFFAOYSA-N SMILES:...
| Schlagworte: | 3-[4-(4-hydroxyphenyl)-1-piperazinyl]-1-phenyl-2,5-pyrrolidinedione |
| Anwendung: | Malic enzyme inhibitor |
| CAS | 522649-59-8 |
| MW: | 351,41 D |
ab 112,00 €
Malic enzyme inhibitor ME1
Artikelnummer: TGM-T11940-100mg
Description: Malic enzyme inhibitor ME1 (ME1) is a specific inhibitor of Malic enzyme (IC50 = 0.15 µM). Malic enzyme inhibitor ME1 reduces cell viability/metabolic activity. Target: Others. Smiles: Oc1ccc(cc1)N1CCN(CC1)C1CC(=O)N(C1=O)c1ccccc1. References: Zhang YJ, et al. In silico design and synthesis of...
| Schlagworte: | ME1 |
| Anwendung: | Malic enzyme inhibitor |
| CAS | 522649-59-8 |
| MW: | 351.4 D |
ab 64,00 €
