Zu "52079-10-4" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
(S)-O-Desmethylnaproxen
Artikelnummer: CDX-D0390-M010
White to off-white solid. Soluble in chloroform. Major naproxen demethylation metabolite. Naproxen demethylation is mediated primarily by CYP2C9. Can be used for assaying naproxen metabolites.
| Schlagworte: | (S)-6-Hydroxy-alpha-methyl-2-naphthaleneacetic acid, (S)-6-O-Desmethylnaproxen |
| Anwendung: | Major naproxen demethylation metabolite |
| CAS | 52079-10-4 |
| MW: | 216,2 D |
ab 183,00 €
(S)-O-Desmethyl Naproxen
Artikelnummer: Cay34199-10
(S)-O-Desmethyl naproxen is a metabolite of the non-steroidal anti-inflammatory drug (NSAID) and COX inhibitor (+)-naproxen ((S)-naproxen, Cay-70290). It is formed from (S)-naproxen by the cytochrome P450 (CYP) isoforms CYP1A2 and CYP2C9.Formal Name: (alphaS)-6-hydroxy-alpha-methyl-2-naphthaleneacetic acid. CAS...
| Schlagworte: | (S)-6-Desmethyl Naproxen, (aS)-6-hydroxy-a-methyl-2-naphthaleneacetic acid |
| Anwendung: | (S)-naproxen metabolite |
| CAS | 52079-10-4 |
| MW: | 216.2 D |
ab 181,00 €
(S)-O-Desmethyl Naproxen
Artikelnummer: TGM-T84994-10mg
Description: (S)-O-Desmethyl naproxen, a metabolite of the non-steroidal anti-inflammatory drug (NSAID) and COX inhibitor (+)-naproxen ((S)-naproxen), is produced through the action of cytochrome P450 (CYP) isoforms CYP1A2 and CYP2C9. Target: Others. Smiles: [C@H](C(O)=O)(C)C1=CC2=C(C=C1)C=C(O)C=C2
| Schlagworte: | (S)-6-Desmethyl Naproxen |
| Anwendung: | (S)-naproxen metabolite |
| CAS | 52079-10-4 |
| MW: | 216.23 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
