Zu "52029-86-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
STO-609
Artikelnummer: Cay31358-1
STO-609 is a calcium/calmodulin-dependent protein kinase kinase (CaMKK) inhibitor (IC50s = 120 and 40 ng/ml for CaMKKalpha and CaMKKbeta, respectively). It is selective for CaMKKs over CaMKI, CaMKII, CaMKIV, MLCK, PKC, PKA, and p42 MAPK (IC50s = >10,000 ng/ml for all). STO-609 inhibits phosphorylation of CaMKI and...
| Schlagworte: | 7-oxo-7H-benzimidazo[2,1-a]benz[de]isoquinoline-3-carboxylic acid |
| Anwendung: | CaMKK inhibitor |
| CAS | 52029-86-4 |
| MW: | 314.3 D |
ab 56,00 €
STO-609
Artikelnummer: TGM-T3546-1mg
Description: STO-609 is a specific and cell-permeable inhibitor of the Ca2+/calmodulin-dependent protein kinase kinase (CaM-KK) for recombinant CaM-KKalpha/KKbeta (Ki: 80/15 ng/mL). Target: Autophagy, AMPK, CaMK. Smiles: C1=CC=C2C(=C1)N=C3N2C(=O)C4=CC=CC5=C(C=CC3=C54)C(=O)O
| Schlagworte: | STO 609 |
| Anwendung: | CaMKK inhibitor |
| CAS | 52029-86-4 |
| MW: | 314.29 D |
ab 34,00 €
