Zu "519178-28-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
TNP
Artikelnummer: TGM-T4487-10mg
Description: TNP (IP3K Inhibitor) is a cell-permeable inhibitor of IP6K1 and IP3K, with IC 50 values of 0.55 µM and 10.2 µM for IP6K1 and IP3K, respectively. TNP binds to the ATP-binding sites of both enzymes [1]. Target: Others. Smiles: [O-][N+](=O)c1ccc(CNc2nc(NCc3cccc(c3)C(F)(F)F)nc3[nH]cnc23)cc1. References:...
| Schlagworte: | IP3K Inhibitor |
| Anwendung: | IP3K inhibitor |
| CAS | 519178-28-0 |
| MW: | 443.38 D |
ab 42,00 €
TNP
Artikelnummer: Cay21189-1
TNP is a cell-permeable inhibitor of inositol-1,4,5-trisphosphate 6-kinase 1 (IP6K1, IC50 = 0.55 µM, Ki = 0.24 µM) and IP3K (IC50 = 10.2 µM, Ki = 4.3 µM) that binds to the ATP-binding sites of both enzymes. TNP reduces IP7 and IP8 levels (IC50s = ~3 and 1 µM, respectively) and inhibits insulin release in MIN6...
| Schlagworte: | IP3K Inhibitor, IP6K Inhibitor, N6-[(4-nitrophenyl)methyl]-N2-[[3-(trifluoromethyl)phenyl]methyl]-9H-purine-2,6-diamine |
| Anwendung: | IP3K inhibitor |
| CAS | 519178-28-0 |
| MW: | 443.4 D |
ab 61,00 €
