Zu "51317-41-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Dopamine 3-O-Sulfate
Artikelnummer: Cay34129-500
Dopamine 3-O-sulfate is a metabolite of the endogenous catecholamine dopamine (Cay-21992). It is formed from dopamine by the sulfotransferase (SULT) isoform SULT1A3. Dopamine 3-O-sulfate is found at higher levels in the brain and circulation than dopamine 4-O-sulfate.Formal Name: 4-(2-aminoethyl)-1,2-benzenediol...
| Schlagworte: | DA-3S, Dopamine 3-Sulfate, 4-(2-aminoethyl)-1,2-benzenediol 2-(hydrogen sulfate) |
| Anwendung: | Dopamine metabolite |
| CAS | 51317-41-0 |
| MW: | 233.2 D |
ab 73,00 €
Dopamine 3-O-sulfate
Artikelnummer: TGM-T73775-1mg
Description: Dopamine 3-O-sulfate, primarily found in plasma, serves as a biomarker for identifying aromatic amino acid decarboxylase (AADC) deficiency [1]. Target: Others. Smiles: NCCc1ccc(O)c(OS(O)(=O)=O)c1
| Anwendung: | Dopamine metabolite |
| CAS | 51317-41-0 |
| MW: | 233.24 D |
ab 115,00 €
