Zu "51234-28-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Benoxaprofen
Artikelnummer: Cay36001-1
Benoxaprofen is a non-steroidal anti-inflammatory drug. It inhibits prostaglandin E2 (PGE2, Cay-14010) and leukotriene C4 (LTC4, Cay-20210) production in isolated mouse peritoneal macrophages stimulated with A23187 (Cay-11016, Cay-22030) when used at a concentration of 100 µM. Benoxaprofen (25 and 50 µg/ml) inhibits...
| Schlagworte: | LRCL 3794, NSC 299582, 2-(4-chlorophenyl)-alpha-methyl-5-benzoxazoleacetic acid |
| Anwendung: | NSAID |
| CAS | 51234-28-7 |
| MW: | 301.7 D |
ab 168,00 €
Benoxaprofen
Artikelnummer: TGM-T19679-100mg
Description: Benoxaprofen (NSC-299582) is a non-steroidal anti-inflammatory drug. Target: COX. Smiles: C(C(O)=O)(C)C=1C=C2C(OC(=N2)C3=CC=C(Cl)C=C3)=CC1. References: Chin KY, El-Kayat B, Milne A, Hart A. Melanoma diagnosed 27 years after a benoxaprofen-induced photosensitivity reaction. J Dermatol Case Rep. 2012 Mar...
| Schlagworte: | NSC 299582, Benoxaphen. Compound 90459, LY-90459 |
| Anwendung: | Targets arachidonate 5-lipoxygenase [EC:1.13.11.34] (ALOX5) |
| CAS | 51234-28-7 |
| MW: | 301.72 D |
ab 200,00 €
