Zu "509-20-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Aconine
Artikelnummer: Cay25048-1
Aconine is an alkaloid originally isolated from Aconitum species and active metabolite of aconitine. It inhibits osteoclast differentiation of RANKL-stimulated RAW 264.7 cells and bone resorption in a pit formation assay in a concentration-dependent manner. Aconine also inhibits RANKL-induced activation of NF-kappaB...
| Schlagworte: | (1alpha,3alpha,6alpha,14alpha,15alpha,16beta)-20-ethyl-1,6,16-trimethoxy-4-(methoxymethyl)-aconitane-3,8,13,14,15-pentol |
| Anwendung: | Bioactive alkaloid |
| CAS | 509-20-6 |
| MW: | 499.6 D |
ab 120,00 €
Aconine
Artikelnummer: TGM-T4S1881-10mg
Description: 1. Aconine (Jesaconine) is the febrifuge. 2. Aconine possesses gastric anaesthetic props. Target: NF-kappaB, Others. Smiles: CCN1C[C@@]2(COC)[C@H]3[C@@H](OC)C4C1C3([C@@H]1C[C@@]3(O)[C@H](O)[C@@H]1[C@]4(O)[C@@H](O)[C@@H]3OC)[C@H](C[C@H]2O)OC. References: Zeng X Z , He L G , Wang S , et al. Aconine...
| Schlagworte: | Jesaconine |
| CAS | 509-20-6 |
| MW: | 499.59 D |
ab 46,00 €
