Zu "50-24-8" wurden 5 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Prednisolone
Artikelnummer: Cay20866-1
Prednisolone is a glucocorticoid and mineralocorticoid receptor agonist and an active metabolite of the prodrugs and synthetic glucocorticoids prednisolone phosphate (Cay-15933) and prednisone (Cay-20677). It selectively binds to the glucocorticoid and mineralocorticoid receptors over the progesterone, androgen, and...
| Schlagworte: | NSC 9120, NSC 9900, 11beta,17,21-trihydroxy-pregna-1,4-diene-3,20-dione |
| Anwendung: | Glucocorticoid receptor agonist |
| CAS | 50-24-8 |
| MW: | 360.4 D |
ab 49,00 €
Prednisolone
Artikelnummer: LKT-P6818.1
Cortisol derivative, glucocorticoid agonist.
| Schlagworte: | Cortalone, Decaprednil, Decortin H, Deltasolone, Flamasone, Hydrodeltalone, Paracortol, Sterolone,... |
| Anwendung: | Glucocorticoid receptor agonist |
| CAS | 50-24-8 |
| MW: | 360.44 D |
ab 60,00 €
Prednisolone
Artikelnummer: TGM-T1560-1mL
Description: Prednisolone (Hydroretrocortine) is a synthetic glucocorticoid with anti-inflammatory and immunomodulating properties. Target: Glucocorticoid Receptor, Endogenous Metabolite. Smiles: CC12CC(O)C3C(CCC4=CC(=O)C=CC34C)C1CCC2(O)C(=O)CO. References: Kolls J, et al. Proc Soc Exp Biol Med, 1994, 205(3), 220-229.
| Schlagworte: | Metacortandralone, Hydroretrocortine, Predonine |
| Anwendung: | Targets glucocorticoid receptor (NR3C1, GR) |
| CAS | 50-24-8 |
| MW: | 360.44 D |
ab 29,00 €
Prednisolone
Artikelnummer: ISO-13402.1
Unlabeled
| Schlagworte: | unlabelled |
| Anwendung: | Steroid |
| CAS | 50-24-8 |
| MW: | 360 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
Prednisolone
Artikelnummer: ISO-S13402.100
| Schlagworte: | unlabelled |
| Anwendung: | Glucocorticoid receptor agonist |
| CAS | 50-24-8 |
| MW: | 360 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
