Zu "49620-14-6" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Radiclonic Acid
Artikelnummer: Cay44992-1
Radiclonic acid is a diterpene that has been found in Talaromyces species and has diverse biological activities. It is active against methicillin-resistant S. aureus (MRSA. MIC = 3. µg/ml). Radiclonic acid is cytotoxic to BIU-87 bladder, Eca-109 esophageal, and BEL-7402 liver cancer cells (IC50s = 12. 7. and 13. µM,...
| Schlagworte: | (2Z,4R)-rel-2-[(2E,4R,6R,8R,10R)-6-(hydroxymethyl)-2,4,8,10-tetramethyl-2-dodecen-1-ylidene]-4-methyl-pentanedioic acid |
| Anwendung: | Bioactive diterpene |
| CAS | 49620-14-6 |
| MW: | 396.57 D |
ab 290,00 €
Radiclonic acid
Artikelnummer: TGM-T124774-1mg
Description: Radiclonic acid is a useful organic compound for research related to life sciences. The catalog number is T124774 and the CAS number is 49620-14-6. Target: Others. Smiles: CCC(C)CC(C)CC(CO)CC(C)\C=C(/C)\C=C(\CC(C)C(O)=O)C(O)=O
| CAS | 49620-14-6 |
| MW: | 396.568 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
