Zu "49557-75-7" wurden 3 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Glycyl-L-Histidyl-L-Lysine
Glycyl-L-Histidyl-L-Lysine

Artikelnummer: TGM-T4508-1g

Description: Glycyl-L-histidyl-L-lysine is a synthetic hepatotrophic agent and liver cell growth factor that stimulates the production of hepatic erythropoietic factor. Target: Others. Smiles: [C@H](CC1=CN=CN1)(C(N[C@@H](CCCCN)C(O)=O)=O)NC(CN)=O. References: Naughton BA,etal.The influence of pancreatic hormones and...
CAS 49557-75-7
MW: 340.38 D
ab 29,00 €
Bewerten
GHK
GHK

Artikelnummer: Cay27168-1

GHK is a peptide released during extracellular matrix (ECM) protein degradation following tissue injury. It binds to copper to form GHK-Cu, a complex with diverse biological activities, including roles in tissue remodeling and wound healing, hair growth, and suppression of inflammation. GHK (1 µM) increases...
Schlagworte: Gly-His-Lys, NSC 379527, glycyl-L-histidyl-L-lysine
Anwendung: Tissue injury extracellular matrix (ECM) protein degradation peptide
CAS 49557-75-7
MW: 340.4 D
ab 49,00 €
Bewerten
TRIPEPTIDE-1
TRIPEPTIDE-1

Artikelnummer: CSB-DT1693.1

Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...
Schlagworte: Gly-His-Lys, GHK
Anwendung: Cosmetic peptide
CAS 49557-75-7
MW: 340.382 D
191,00 €
Bewerten