Zu "491-72-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Olivetolic Acid
Artikelnummer: Cay26282-25
Olivetolic acid (Cay-26282) is an analytical reference standard categorized as an intermediate in the phytocannabinoid biosynthetic pathway. Olivetolic acid is a precursor in the synthesis of cannabigerolic acid (CBGA, Cay-20019, Cay-9001572), Delta9-tetrahydrocannabinol (Delta9-THC, Cay-ISO60157, Cay-12068), and...
| Schlagworte: | OA, OLA, Olivetolate, Olivetolcarboxylic Acid, 2,4-dihydroxy-6-pentyl-benzoic acid |
| Anwendung: | Analytical reference standard |
| CAS | 491-72-5 |
| MW: | 224.3 D |
ab 144,00 €
Olivetolic acid
Artikelnummer: TGM-TN7252-100mg
Description: Olivetolic acid (OLA) is a precursor of cannabinoids from Cannabis sativa and has shown anticonvulsant activity in a mouse model of Dravet syndrome.Olivetolic acid has potential antimicrobial activity. Target: Others, Antibiotic. Smiles: CCCCCc1cc(O)cc(O)c1C(O)=O. References: Anderson LL,et al....
| Schlagworte: | 2,4-Dihydroxy-6-pentylbenzoic acid |
| CAS | 491-72-5 |
| MW: | 224.25 D |
ab 30,00 €
