Zu "488-84-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
D-Ribulose
Artikelnummer: Cay18893-10
Ribulose is a ketopentose, a monosaccharide containing five carbon atoms and a ketone functional group. It is synthesized in the pentose phosphate pathway and plays a role in the formation of various bioactive compounds. It is a structural isomer of ribose and exists as two enantiomers, D-ribulose and L-ribulose. A...
| Schlagworte: | D-Adonose, D-erythro-2-pentulose |
| Anwendung: | Ketopentose, pentose phosphate pathway intermediate |
| CAS | 488-84-6 |
| MW: | 150.1 D |
ab 58,00 €
D-Ribulose
Artikelnummer: TGM-T37987-10mg
Description: D-Ribulose has potential as an anticancer and antiviral compound and is a rare sugar used in the food, agricultural and pharmaceutical industries. Target: Antiviral. Smiles: [C@@H]([C@@H](CO)O)(C(CO)=O)O. References: Iqbal MW, et al. A review on selective l-fucose/d-arabinose isomerases for biocatalytic...
| CAS | 488-84-6 |
| MW: | 150.13 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
