Zu "479-13-0" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Coumestrol
Artikelnummer: TGM-TQ0295-10mg
Description: Coumestrol that existed in soybean products suppresses the proliferation of ES2 cells (IC50: 50 µM). It exhibits activities against neurological disorders, cancers and autoimmune diseases. Target: Estrogen Receptor/ERR. Smiles: Oc1ccc2c(c1)oc1c2c(=O)oc2cc(O)ccc12. References: Zafar A, et al. Cytotoxic...
| Anwendung: | 17-beta-hydroxysteroid oxidoreductase inhibitor |
| CAS | 479-13-0 |
| MW: | 268.22 D |
ab 42,00 €
Coumestrol
Artikelnummer: Cay11730-5
Coumestrol is a phytoestrogen that occurs naturally in soybeans, spinach, and clover. It competitively (vs. 17beta-estradiol, Cay-10006315) binds the estrogen receptors ERalpha (IC50 = 11 nM) and ERbeta (IC50 = 2 nM) and can induce ER-dependent gene expression in isolated cells. Coumestrol is also a weak antagonist...
| Schlagworte: | NSC 22842, 3,9-dihydroxy-6H-benzofuro[3,2-c][1]benzopyran-6-one |
| Anwendung: | Pregnane X receptor antagonist |
| CAS | 479-13-0 |
| MW: | 268.2 D |
ab 61,00 €
Coumestrol
Artikelnummer: LKT-C5680.10
A plant estrogen, and highly potent inhibitor of 17-beta?hydroxysteroid oxidoreductase.
| Schlagworte: | Cumoesterol, Cumoestrol, Cumostrol |
| Anwendung: | 17-beta-hydroxysteroid oxidoreductase inhibitor |
| CAS | 479-13-0 |
| MW: | 268,2 D |
ab 455,00 €
