Zu "475205-49-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
A-317491
Artikelnummer: TGM-TQ0002-100mg
Description: A-317491 (ABT 202) is a non-nucleotide P2X3 ( Ki: 22 nM) and P2X2/3 receptor (Ki: 9 nM) antagonist, which inhibits calcium flux mediated by the receptors. Target: P2X Receptor. Smiles: OC(=O)c1cc(C(O)=O)c(cc1C(O)=O)C(=O)N(Cc1cccc(Oc2ccccc2)c1)[C@H]1CCCc2ccccc12. References: Jarvis MF,et al. A-317491, a...
| Schlagworte: | ABT 202 |
| Anwendung: | Non-nucleotide P2X3 / P2X2/3 receptor antagonist |
| CAS | 475205-49-3 |
| MW: | 565.57 D |
ab 31,00 €
A-317491
Artikelnummer: Cay19256-1
A-317491 is a non-nucleotide antagonist of the purinergic receptors P2X3 and P2X2/3 (Kis = 22-92 nM in a calcium influx assay) that is selective over other purinergic and neurotransmitter receptors, ion channels, and enzymes (IC50s = >10 µM). It reduces thermal hyperalgesia induced by complete Freund's adjuvant in...
| Schlagworte: | 5-[[[(3-phenoxyphenyl)methyl][(1S)-1,2,3,4-tetrahydro-1-naphthalenyl]amino]carbonyl]-1,2,4-benzenetricarboxylic acid |
| Anwendung: | Non-nucleotide P2X3 / P2X2/3 receptor antagonist |
| CAS | 475205-49-3 |
| MW: | 565.6 D |
ab 49,00 €
